C11H8BrNOS — CID 115089496
2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 115089496) has the molecular formula C11H8BrNOS and a molecular weight of 282.16 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 115089496 |
| Molecular Formula | C11H8BrNOS |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C11H8BrNOS/c12-10-4-2-1-3-9(10)11-13-8(5-6-14)7-15-11/h1-4,6-7H,5H2 |
| InChIKey | KUJGSGBNUNXSPQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|