C9H16BrNO2S — CID 153389943
2-(2-bromo-1,3-thiazol-4-yl)acetaldehyde;ethane;methoxymethane (PubChem CID 153389943) has the molecular formula C9H16BrNO2S and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-(2-bromo-1,3-thiazol-4-yl)acetaldehyde;ethane;methoxymethane.
| Compound Name | 2-(2-bromo-1,3-thiazol-4-yl)acetaldehyde;ethane;methoxymethane |
|---|---|
| PubChem CID | 153389943 |
| Molecular Formula | C9H16BrNO2S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-(2-bromo-1,3-thiazol-4-yl)acetaldehyde;ethane;methoxymethane |
| SMILES | CC.COC.O=CCc1csc(Br)n1 |
| InChI | InChI=1S/C5H4BrNOS.C2H6O.C2H6/c6-5-7-4(1-2-8)3-9-5;1-3-2;1-2/h2-3H,1H2;1-2H3;1-2H3 |
| InChIKey | LECOLHMFNQLHKF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|