C9H14N2OS — CID 83880353
2-[2-[methyl(propan-2-yl)amino]-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 83880353) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-[2-[methyl(propan-2-yl)amino]-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-[methyl(propan-2-yl)amino]-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 83880353 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-[2-[methyl(propan-2-yl)amino]-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | CC(C)N(C)c1nc(CC=O)cs1 |
| InChI | InChI=1S/C9H14N2OS/c1-7(2)11(3)9-10-8(4-5-12)6-13-9/h5-7H,4H2,1-3H3 |
| InChIKey | IHBIZUCKDVDNNK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|