C16H32N6S — CID 111964597
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine (PubChem CID 111964597) has the molecular formula C16H32N6S and a molecular weight of 340.54 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111964597 |
| Molecular Formula | C16H32N6S |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1csc(N(C)C)n1 |
| InChI | InChI=1S/C16H32N6S/c1-12(2)22(13(3)4)9-8-18-15(17-5)19-10-14-11-23-16(20-14)21(6)7/h11-13H,8-10H2,1-7H3,(H2,17,18,19) |
| InChIKey | LIFGXMISQOONGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|