C15H23IN6S — CID 111964356
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111964356) has the molecular formula C15H23IN6S and a molecular weight of 446.36 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111964356 |
| Molecular Formula | C15H23IN6S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccn1)NCc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C15H22N6S.HI/c1-16-14(18-9-7-12-6-4-5-8-17-12)19-10-13-11-22-15(20-13)21(2)3;/h4-6,8,11H,7,9-10H2,1-3H3,(H2,16,18,19);1H |
| InChIKey | SPYYWBPNFQWMIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|