C16H26IN7S — CID 109404730
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109404730) has the molecular formula C16H26IN7S and a molecular weight of 475.40 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109404730 |
| Molecular Formula | C16H26IN7S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(N(C)C)n1)NCc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C16H25N7S.HI/c1-17-15(19-10-13-11-24-16(21-13)23(4)5)18-9-12-7-6-8-14(20-12)22(2)3;/h6-8,11H,9-10H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | FYENNLOBTIFWDU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|