C15H20ClN5S — CID 111964187
1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine (PubChem CID 111964187) has the molecular formula C15H20ClN5S and a molecular weight of 337.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111964187 |
| Molecular Formula | C15H20ClN5S |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1)NCc1csc(N(C)C)n1 |
| InChI | InChI=1S/C15H20ClN5S/c1-17-14(18-8-11-4-6-12(16)7-5-11)19-9-13-10-22-15(20-13)21(2)3/h4-7,10H,8-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | BBYMMRBXEYVZTG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|