C11H22IN5S2 — CID 111964940
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111964940) has the molecular formula C11H22IN5S2 and a molecular weight of 415.37 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111964940 |
| Molecular Formula | C11H22IN5S2 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C11H21N5S2.HI/c1-12-10(13-5-6-17-4)14-7-9-8-18-11(15-9)16(2)3;/h8H,5-7H2,1-4H3,(H2,12,13,14);1H |
| InChIKey | PXVGLQXFQJRPJT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|