C17H23F3IN5S — CID 111964748
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111964748) has the molecular formula C17H23F3IN5S and a molecular weight of 513.37 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111964748 |
| Molecular Formula | C17H23F3IN5S |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C17H22F3N5S.HI/c1-21-15(23-10-14-11-26-16(24-14)25(2)3)22-9-8-12-4-6-13(7-5-12)17(18,19)20;/h4-7,11H,8-10H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | VAAXULFVEFNFPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|