C17H21F3N4S — CID 111774668
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111774668) has the molecular formula C17H21F3N4S and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111774668 |
| Molecular Formula | C17H21F3N4S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C17H21F3N4S/c1-11-12(2)25-15(24-11)10-23-16(21-3)22-9-8-13-4-6-14(7-5-13)17(18,19)20/h4-7H,8-10H2,1-3H3,(H2,21,22,23) |
| InChIKey | RXRVLYYFVHQAIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|