C15H28IN5OS — CID 111988274
N-[2-[[N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111988274) has the molecular formula C15H28IN5OS and a molecular weight of 453.39 g/mol. Its IUPAC name is N-[2-[[N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111988274 |
| Molecular Formula | C15H28IN5OS |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-[2-[[N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCc1nc(C)c(C)s1.I |
| InChI | InChI=1S/C15H27N5OS.HI/c1-10-11(2)22-12(20-10)9-19-14(16-6)18-8-7-17-13(21)15(3,4)5;/h7-9H2,1-6H3,(H,17,21)(H2,16,18,19);1H |
| InChIKey | URJQMQAZAIRQFK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|