C19H27F3IN5 — CID 111295280
2-methyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111295280) has the molecular formula C19H27F3IN5 and a molecular weight of 509.36 g/mol. Its IUPAC name is 2-methyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295280 |
| Molecular Formula | C19H27F3IN5 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 2-methyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C19H26F3N5.HI/c1-13-17(14(2)27(4)26-13)10-12-25-18(23-3)24-11-9-15-5-7-16(8-6-15)19(20,21)22;/h5-8H,9-12H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | MJEBULYCJQYIEN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|