C15H22F3IN6S — CID 111616572
2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111616572) has the molecular formula C15H22F3IN6S and a molecular weight of 502.35 g/mol. Its IUPAC name is 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616572 |
| Molecular Formula | C15H22F3IN6S |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c(C)nn(C)c1C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H21F3N6S.HI/c1-9-11(10(2)24(4)23-9)5-6-20-14(19-3)21-7-13-22-12(8-25-13)15(16,17)18;/h8H,5-7H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | SMONKPFAGIWTJC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|