C12H16F3N7S — CID 111615766
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615766) has the molecular formula C12H16F3N7S and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615766 |
| Molecular Formula | C12H16F3N7S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1nc(C(F)(F)F)cs1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C12H16F3N7S/c1-7-20-21-9(22(7)3)4-17-11(16-2)18-5-10-19-8(6-23-10)12(13,14)15/h6H,4-5H2,1-3H3,(H2,16,17,18) |
| InChIKey | GQFYHVJHRWSJNG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|