C16H19F3N4S — CID 111615938
1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615938) has the molecular formula C16H19F3N4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615938 |
| Molecular Formula | C16H19F3N4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)NCc1ccc(C)cc1C |
| InChI | InChI=1S/C16H19F3N4S/c1-10-4-5-12(11(2)6-10)7-21-15(20-3)22-8-14-23-13(9-24-14)16(17,18)19/h4-6,9H,7-8H2,1-3H3,(H2,20,21,22) |
| InChIKey | RAKDFQJEXMIOIH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|