C12H12BrF3N4S2 — CID 111615613
1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615613) has the molecular formula C12H12BrF3N4S2 and a molecular weight of 413.29 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615613 |
| Molecular Formula | C12H12BrF3N4S2 |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(Br)s1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H12BrF3N4S2/c1-17-11(18-4-7-2-3-9(13)22-7)19-5-10-20-8(6-21-10)12(14,15)16/h2-3,6H,4-5H2,1H3,(H2,17,18,19) |
| InChIKey | KVTZPNJBWCCNLQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|