C17H19F3IN5S3 — CID 111616869
2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616869) has the molecular formula C17H19F3IN5S3 and a molecular weight of 573.47 g/mol. Its IUPAC name is 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616869 |
| Molecular Formula | C17H19F3IN5S3 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(-c2csc(C)n2)s1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H18F3N5S3.HI/c1-10-24-12(8-26-10)13-4-3-11(28-13)5-6-22-16(21-2)23-7-15-25-14(9-27-15)17(18,19)20;/h3-4,8-9H,5-7H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | JHBRHXDYNQOIHK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|