C19H30IN5O2S2 — CID 111883812
tert-butyl N-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883812) has the molecular formula C19H30IN5O2S2 and a molecular weight of 551.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883812 |
| Molecular Formula | C19H30IN5O2S2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCCc1ccc(-c2csc(C)n2)s1.I |
| InChI | InChI=1S/C19H29N5O2S2.HI/c1-13-24-15(12-27-13)16-7-6-14(28-16)8-9-21-17(20-5)22-10-11-23-18(25)26-19(2,3)4;/h6-7,12H,8-11H2,1-5H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | ZXUVEFYMJZJQFE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|