C22H27N5OS2 — CID 111633859
N-methyl-3-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111633859) has the molecular formula C22H27N5OS2 and a molecular weight of 441.63 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-methyl-3-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111633859 |
| Molecular Formula | C22H27N5OS2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-methyl-3-[2-[[N'-methyl-N-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCCc1ccc(-c2csc(C)n2)s1 |
| InChI | InChI=1S/C22H27N5OS2/c1-15-27-19(14-29-15)20-8-7-18(30-20)10-12-26-22(24-3)25-11-9-16-5-4-6-17(13-16)21(28)23-2/h4-8,13-14H,9-12H2,1-3H3,(H,23,28)(H2,24,25,26) |
| InChIKey | WJFZLYPZXRBFPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|