C16H22IN7S2 — CID 111708090
2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111708090) has the molecular formula C16H22IN7S2 and a molecular weight of 503.44 g/mol. Its IUPAC name is 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111708090 |
| Molecular Formula | C16H22IN7S2 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 2-methyl-1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(-c2csc(C)n2)s1)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H21N7S2.HI/c1-11-22-13(9-24-11)14-5-4-12(25-14)6-7-18-16(17-2)19-8-15-20-10-21-23(15)3;/h4-5,9-10H,6-8H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | CKCUBGPHVDDIJA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|