C12H19IN6S — CID 111704928
2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111704928) has the molecular formula C12H19IN6S and a molecular weight of 406.30 g/mol. Its IUPAC name is 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111704928 |
| Molecular Formula | C12H19IN6S |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1sccc1C)NCc1ncnn1C.I |
| InChI | InChI=1S/C12H18N6S.HI/c1-9-4-5-19-10(9)6-14-12(13-2)15-7-11-16-8-17-18(11)3;/h4-5,8H,6-7H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | JSOOUGFYOYKMPL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|