C20H28IN5OS2 — CID 111594513
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111594513) has the molecular formula C20H28IN5OS2 and a molecular weight of 545.52 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111594513 |
| Molecular Formula | C20H28IN5OS2 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(-c2csc(C)n2)s1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C20H27N5OS2.HI/c1-13-25-15(12-27-13)16-7-6-14(28-16)8-9-22-19(21-5)24-11-18-23-10-17(26-18)20(2,3)4;/h6-7,10,12H,8-9,11H2,1-5H3,(H2,21,22,24);1H |
| InChIKey | VFQGGWSPOVQXGG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|