C21H27IN4O2S2 — CID 111878462
1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111878462) has the molecular formula C21H27IN4O2S2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111878462 |
| Molecular Formula | C21H27IN4O2S2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(-c2csc(C)n2)s1)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H26N4O2S2.HI/c1-14-25-18(13-28-14)20-8-7-17(29-20)9-10-23-21(22-2)24-12-15-5-6-16(26-3)11-19(15)27-4;/h5-8,11,13H,9-10,12H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | MTMHNKVTOTWWHN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|