C18H23N7O — CID 111705041
2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705041) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705041 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(C)cc2)n1)NCc1ncnn1C |
| InChI | InChI=1S/C18H23N7O/c1-13-4-6-14(7-5-13)17-24-15(11-26-17)8-9-20-18(19-2)21-10-16-22-12-23-25(16)3/h4-7,11-12H,8-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | LFCSAACGPIFMRZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|