C12H23N5S — CID 111964323
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylpropyl)guanidine (PubChem CID 111964323) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylpropyl)guanidine.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111964323 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-methylpropyl)guanidine |
| SMILES | C/N=C(/NCc1csc(N(C)C)n1)NCC(C)C |
| InChI | InChI=1S/C12H23N5S/c1-9(2)6-14-11(13-3)15-7-10-8-18-12(16-10)17(4)5/h8-9H,6-7H2,1-5H3,(H2,13,14,15) |
| InChIKey | UAKTYKJTAGSSTC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|