C16H24N6S — CID 109404735
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109404735) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109404735 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccncc1C)NCc1csc(N(C)C)n1 |
| InChI | InChI=1S/C16H24N6S/c1-12-9-18-7-5-13(12)6-8-19-15(17-2)20-10-14-11-23-16(21-14)22(3)4/h5,7,9,11H,6,8,10H2,1-4H3,(H2,17,19,20) |
| InChIKey | FQMTZXJJUSHOHB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|