C15H30IN5S — CID 111964368
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide (PubChem CID 111964368) has the molecular formula C15H30IN5S and a molecular weight of 439.41 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111964368 |
| Molecular Formula | C15H30IN5S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N\C)NCc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C15H29N5S.HI/c1-6-7-8-9-12(2)18-14(16-3)17-10-13-11-21-15(19-13)20(4)5;/h11-12H,6-10H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | LHOOXDDXLRCASQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|