C18H23ClN4 — CID 111131456
1-[(4-chlorophenyl)methyl]-3-[[3-(dimethylamino)phenyl]methyl]-2-methylguanidine (PubChem CID 111131456) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[3-(dimethylamino)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[3-(dimethylamino)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111131456 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[3-(dimethylamino)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C18H23ClN4/c1-20-18(21-12-14-7-9-16(19)10-8-14)22-13-15-5-4-6-17(11-15)23(2)3/h4-11H,12-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | BFKPQWWVWDILQE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|