C18H32N4 — CID 111204582
1-[[3-(dimethylamino)phenyl]methyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111204582) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-[[3-(dimethylamino)phenyl]methyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 1-[[3-(dimethylamino)phenyl]methyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111204582 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1-[[3-(dimethylamino)phenyl]methyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine |
| SMILES | C/N=C(/NCc1cccc(N(C)C)c1)NC(C)CCC(C)C |
| InChI | InChI=1S/C18H32N4/c1-14(2)10-11-15(3)21-18(19-4)20-13-16-8-7-9-17(12-16)22(5)6/h7-9,12,14-15H,10-11,13H2,1-6H3,(H2,19,20,21) |
| InChIKey | VESHPECHIUEHLQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|