C9H12BrNO2S — CID 133060403
butan-2-yl 2-(2-bromo-1,3-thiazol-4-yl)acetate (PubChem CID 133060403) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is butan-2-yl 2-(2-bromo-1,3-thiazol-4-yl)acetate.
| Compound Name | butan-2-yl 2-(2-bromo-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 133060403 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | butan-2-yl 2-(2-bromo-1,3-thiazol-4-yl)acetate |
| SMILES | CCC(C)OC(=O)Cc1csc(Br)n1 |
| InChI | InChI=1S/C9H12BrNO2S/c1-3-6(2)13-8(12)4-7-5-14-9(10)11-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | OMORZUZVGVAXRA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |