C18H17N3O2S — CID 54579697
1-phenylpropan-2-yl 2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 54579697) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-phenylpropan-2-yl 2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | 1-phenylpropan-2-yl 2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 54579697 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-phenylpropan-2-yl 2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | CC(Cc1ccccc1)OC(=O)Cc1csc(-c2ncccn2)n1 |
| InChI | InChI=1S/C18H17N3O2S/c1-13(10-14-6-3-2-4-7-14)23-16(22)11-15-12-24-18(21-15)17-19-8-5-9-20-17/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | YHWRIZIOGVMJKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |