C7H7ClN2O2S — CID 54546949
2-chloro-N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 54546949) has the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. Its IUPAC name is 2-chloro-N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 54546949 |
| Molecular Formula | C7H7ClN2O2S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2-chloro-N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=CCc1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C7H7ClN2O2S/c8-3-6(12)10-7-9-5(1-2-11)4-13-7/h2,4H,1,3H2,(H,9,10,12) |
| InChIKey | NVMVTLNZHOGKFG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|