C11H9ClN2OS — CID 123698759
2-[2-(4-chloroanilino)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 123698759) has the molecular formula C11H9ClN2OS and a molecular weight of 252.73 g/mol. Its IUPAC name is 2-[2-(4-chloroanilino)-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-(4-chloroanilino)-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 123698759 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-[2-(4-chloroanilino)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C11H9ClN2OS/c12-8-1-3-9(4-2-8)13-11-14-10(5-6-15)7-16-11/h1-4,6-7H,5H2,(H,13,14) |
| InChIKey | MTNOJBTZYBRNCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|