C10H7Cl3N2S — CID 82179811
4-(chloromethyl)-N-(3,5-dichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 82179811) has the molecular formula C10H7Cl3N2S and a molecular weight of 293.61 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(3,5-dichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(chloromethyl)-N-(3,5-dichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82179811 |
| Molecular Formula | C10H7Cl3N2S |
| Molecular Weight | 293.61 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 4-(chloromethyl)-N-(3,5-dichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | ClCc1csc(Nc2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C10H7Cl3N2S/c11-4-9-5-16-10(15-9)14-8-2-6(12)1-7(13)3-8/h1-3,5H,4H2,(H,14,15) |
| InChIKey | BJAYMPNQHQSYKE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|