C7H9ClN2S — CID 88640379
4-(chloromethyl)-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 88640379) has the molecular formula C7H9ClN2S and a molecular weight of 188.68 g/mol. Its IUPAC name is 4-(chloromethyl)-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 4-(chloromethyl)-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 88640379 |
| Molecular Formula | C7H9ClN2S |
| Molecular Weight | 188.68 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 4-(chloromethyl)-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(CCl)cs1 |
| InChI | InChI=1S/C7H9ClN2S/c1-2-3-9-7-10-6(4-8)5-11-7/h2,5H,1,3-4H2,(H,9,10) |
| InChIKey | RVYYVUSIBPHDKF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|