C14H11BrClN2OS- — CID 45108453
4-(5-chloro-1-benzofuran-2-yl)-N-prop-2-enyl-1,3-thiazol-2-amine bromide (PubChem CID 45108453) has the molecular formula C14H11BrClN2OS- and a molecular weight of 370.68 g/mol. Its IUPAC name is 4-(5-chloro-1-benzofuran-2-yl)-N-prop-2-enyl-1,3-thiazol-2-amine bromide.
| Compound Name | 4-(5-chloro-1-benzofuran-2-yl)-N-prop-2-enyl-1,3-thiazol-2-amine bromide |
|---|---|
| PubChem CID | 45108453 |
| Molecular Formula | C14H11BrClN2OS- |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 4-(5-chloro-1-benzofuran-2-yl)-N-prop-2-enyl-1,3-thiazol-2-amine bromide |
| SMILES | C=CCNc1nc(-c2cc3cc(Cl)ccc3o2)cs1.[Br-] |
| InChI | InChI=1S/C14H11ClN2OS.BrH/c1-2-5-16-14-17-11(8-19-14)13-7-9-6-10(15)3-4-12(9)18-13;/h2-4,6-8H,1,5H2,(H,16,17);1H/p-1 |
| InChIKey | ADWOYDQHWJPLKL-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|