C15H8ClN3OS — CID 47061944
4-(5-chloro-1-benzofuran-2-yl)-2-pyrazin-2-yl-1,3-thiazole (PubChem CID 47061944) has the molecular formula C15H8ClN3OS and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-(5-chloro-1-benzofuran-2-yl)-2-pyrazin-2-yl-1,3-thiazole.
| Compound Name | 4-(5-chloro-1-benzofuran-2-yl)-2-pyrazin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 47061944 |
| Molecular Formula | C15H8ClN3OS |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-(5-chloro-1-benzofuran-2-yl)-2-pyrazin-2-yl-1,3-thiazole |
| SMILES | Clc1ccc2oc(-c3csc(-c4cnccn4)n3)cc2c1 |
| InChI | InChI=1S/C15H8ClN3OS/c16-10-1-2-13-9(5-10)6-14(20-13)12-8-21-15(19-12)11-7-17-3-4-18-11/h1-8H |
| InChIKey | YYBPTXZRYAERBU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |