C8H6ClN3S — CID 23025076
4-(chloromethyl)-2-pyrazin-2-yl-1,3-thiazole (PubChem CID 23025076) has the molecular formula C8H6ClN3S and a molecular weight of 211.68 g/mol. Its IUPAC name is 4-(chloromethyl)-2-pyrazin-2-yl-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-pyrazin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 23025076 |
| Molecular Formula | C8H6ClN3S |
| Molecular Weight | 211.68 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 4-(chloromethyl)-2-pyrazin-2-yl-1,3-thiazole |
| SMILES | ClCc1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C8H6ClN3S/c9-3-6-5-13-8(12-6)7-4-10-1-2-11-7/h1-2,4-5H,3H2 |
| InChIKey | DMFHNMOSYIRQJI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|