ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate

C12H13N3O2S — CID 103485378

IUPACethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate
SMILESCCOC(=O)CCc1csc(-c2cnccn2)n1
InChIInChI=1S/C12H13N3O2S/c1-2-17-11(16)4-3-9-8-18-12(15-9)10-7-13-5-6-14-10/h5-8H,2-4H2,1H3
InChIKeyRYKNLFSCYUDDRN-UHFFFAOYSA-N
MW263.32 g/mol
LogP2.10
Rot. Bonds5

About ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate

ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate (PubChem CID 103485378) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate.

Molecular Properties

Compound Nameethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate
PubChem CID103485378
Molecular FormulaC12H13N3O2S
Molecular Weight263.32 g/mol
Exact Mass263.07
IUPAC Nameethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate
SMILESCCOC(=O)CCc1csc(-c2cnccn2)n1
InChIInChI=1S/C12H13N3O2S/c1-2-17-11(16)4-3-9-8-18-12(15-9)10-7-13-5-6-14-10/h5-8H,2-4H2,1H3
InChIKeyRYKNLFSCYUDDRN-UHFFFAOYSA-N
XLogP2.10
TPSA64.97 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 52.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate?
The IUPAC name of ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate (CID 103485378) is ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate.
What is the SMILES notation for ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate?
The canonical SMILES for ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate is CCOC(=O)CCc1csc(-c2cnccn2)n1.
What is the InChIKey of ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate?
The InChIKey is RYKNLFSCYUDDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S/c1-2-17-11(16)4-3-9-8-18-12(15-9)10-7-13-5-6-14-10/h5-8H,2-4H2,1H3.
What are the key properties of ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate?
ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate has a molecular weight of 263.32 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate is sourced from PubChem (CID 103485378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).