C12H13N3O2S — CID 103485378
ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate (PubChem CID 103485378) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate.
| Compound Name | ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate |
|---|---|
| PubChem CID | 103485378 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl 3-(2-pyrazin-2-yl-1,3-thiazol-4-yl)propanoate |
| SMILES | CCOC(=O)CCc1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-11(16)4-3-9-8-18-12(15-9)10-7-13-5-6-14-10/h5-8H,2-4H2,1H3 |
| InChIKey | RYKNLFSCYUDDRN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |