About ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate
ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate (PubChem CID 103485384) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate.
Analyze ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate?
The IUPAC name of ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate (CID 103485384) is ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate.
What is the SMILES notation for ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate?
The canonical SMILES for ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate is CCOC(=O)CCc1csc(CC(C)(C)C)n1.
What is the InChIKey of ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate?
The InChIKey is KBHALDMOWLTKQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2S/c1-5-16-12(15)7-6-10-9-17-11(14-10)8-13(2,3)4/h9H,5-8H2,1-4H3.
What are the key properties of ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate?
ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate has a molecular weight of 255.38 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]propanoate is sourced from PubChem (CID 103485384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).