C16H16ClN3O — CID 114734715
6-(5-chloro-1-benzofuran-2-yl)-N,2-diethylpyrimidin-4-amine (PubChem CID 114734715) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 6-(5-chloro-1-benzofuran-2-yl)-N,2-diethylpyrimidin-4-amine.
| Compound Name | 6-(5-chloro-1-benzofuran-2-yl)-N,2-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114734715 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 6-(5-chloro-1-benzofuran-2-yl)-N,2-diethylpyrimidin-4-amine |
| SMILES | CCNc1cc(-c2cc3cc(Cl)ccc3o2)nc(CC)n1 |
| InChI | InChI=1S/C16H16ClN3O/c1-3-15-19-12(9-16(20-15)18-4-2)14-8-10-7-11(17)5-6-13(10)21-14/h5-9H,3-4H2,1-2H3,(H,18,19,20) |
| InChIKey | RZTPZYJBXJRTRD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |