C14H15F2N3 — CID 80936764
6-(2,5-difluorophenyl)-N,2-diethylpyrimidin-4-amine (PubChem CID 80936764) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)-N,2-diethylpyrimidin-4-amine.
| Compound Name | 6-(2,5-difluorophenyl)-N,2-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80936764 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 6-(2,5-difluorophenyl)-N,2-diethylpyrimidin-4-amine |
| SMILES | CCNc1cc(-c2cc(F)ccc2F)nc(CC)n1 |
| InChI | InChI=1S/C14H15F2N3/c1-3-13-18-12(8-14(19-13)17-4-2)10-7-9(15)5-6-11(10)16/h5-8H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | GKZHNZWXNBMYCP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |