C15H16F3N3 — CID 80939393
N-ethyl-2-propyl-6-(2,3,4-trifluorophenyl)pyrimidin-4-amine (PubChem CID 80939393) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-ethyl-2-propyl-6-(2,3,4-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-2-propyl-6-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80939393 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-ethyl-2-propyl-6-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
| SMILES | CCCc1nc(NCC)cc(-c2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C15H16F3N3/c1-3-5-12-20-11(8-13(21-12)19-4-2)9-6-7-10(16)15(18)14(9)17/h6-8H,3-5H2,1-2H3,(H,19,20,21) |
| InChIKey | SIMPCXXGOKFTJT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|