C15H18FN3 — CID 80945378
N-ethyl-6-(3-fluorophenyl)-2-propylpyrimidin-4-amine (PubChem CID 80945378) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is N-ethyl-6-(3-fluorophenyl)-2-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-(3-fluorophenyl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80945378 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-ethyl-6-(3-fluorophenyl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NCC)cc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H18FN3/c1-3-6-14-18-13(10-15(19-14)17-4-2)11-7-5-8-12(16)9-11/h5,7-10H,3-4,6H2,1-2H3,(H,17,18,19) |
| InChIKey | CAOXSOJQLKFWEN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |