C14H16FN3 — CID 80936579
N,2-diethyl-6-(3-fluorophenyl)pyrimidin-4-amine (PubChem CID 80936579) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is N,2-diethyl-6-(3-fluorophenyl)pyrimidin-4-amine.
| Compound Name | N,2-diethyl-6-(3-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80936579 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N,2-diethyl-6-(3-fluorophenyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(-c2cccc(F)c2)nc(CC)n1 |
| InChI | InChI=1S/C14H16FN3/c1-3-13-17-12(9-14(18-13)16-4-2)10-6-5-7-11(15)8-10/h5-9H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | PBKLOCKTRASTJC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |