C15H15F2N3 — CID 80952411
2-cyclopropyl-6-(2,5-difluorophenyl)-N-ethylpyrimidin-4-amine (PubChem CID 80952411) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2,5-difluorophenyl)-N-ethylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-(2,5-difluorophenyl)-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80952411 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-cyclopropyl-6-(2,5-difluorophenyl)-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(-c2cc(F)ccc2F)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H15F2N3/c1-2-18-14-8-13(19-15(20-14)9-3-4-9)11-7-10(16)5-6-12(11)17/h5-9H,2-4H2,1H3,(H,18,19,20) |
| InChIKey | NQWXMSJOMXAZRH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |