C11H10ClN3S2 — CID 108783783
1-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-phenylthiourea (PubChem CID 108783783) has the molecular formula C11H10ClN3S2 and a molecular weight of 283.81 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-phenylthiourea.
| Compound Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 108783783 |
| Molecular Formula | C11H10ClN3S2 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H10ClN3S2/c12-6-9-7-17-11(14-9)15-10(16)13-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,13,14,15,16) |
| InChIKey | JLFRRFIQXPGGOZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|