C13H13N5O2S2 — CID 166005650
N-[4-[(phenylcarbamothioylamino)carbamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 166005650) has the molecular formula C13H13N5O2S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[4-[(phenylcarbamothioylamino)carbamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(phenylcarbamothioylamino)carbamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 166005650 |
| Molecular Formula | C13H13N5O2S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[4-[(phenylcarbamothioylamino)carbamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C(=O)NNC(=S)Nc2ccccc2)cs1 |
| InChI | InChI=1S/C13H13N5O2S2/c1-8(19)14-13-16-10(7-22-13)11(20)17-18-12(21)15-9-5-3-2-4-6-9/h2-7H,1H3,(H,17,20)(H,14,16,19)(H2,15,18,21) |
| InChIKey | YKAVPIOHRSRJEU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|