C9H11N3O4S — CID 43170831
2-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]propanoic acid (PubChem CID 43170831) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 43170831 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]propanoic acid |
| SMILES | CC(=O)Nc1nc(C(=O)NC(C)C(=O)O)cs1 |
| InChI | InChI=1S/C9H11N3O4S/c1-4(8(15)16)10-7(14)6-3-17-9(12-6)11-5(2)13/h3-4H,1-2H3,(H,10,14)(H,15,16)(H,11,12,13) |
| InChIKey | QCOWLPRYQNARMN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |