C14H15N3O3S — CID 103772744
2-acetamido-N-[(1R)-2-hydroxy-1-phenylethyl]-1,3-thiazole-4-carboxamide (PubChem CID 103772744) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-acetamido-N-[(1R)-2-hydroxy-1-phenylethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[(1R)-2-hydroxy-1-phenylethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103772744 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-acetamido-N-[(1R)-2-hydroxy-1-phenylethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)N[C@@H](CO)c2ccccc2)cs1 |
| InChI | InChI=1S/C14H15N3O3S/c1-9(19)15-14-17-12(8-21-14)13(20)16-11(7-18)10-5-3-2-4-6-10/h2-6,8,11,18H,7H2,1H3,(H,16,20)(H,15,17,19)/t11-/m0/s1 |
| InChIKey | HXHTZOZXFZYULA-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |